C11H12FN — CID 119086663
5-fluoro-2-prop-2-enyl-2,3-dihydro-1H-indole (PubChem CID 119086663) has the molecular formula C11H12FN and a molecular weight of 177.22 g/mol. Its IUPAC name is 5-fluoro-2-prop-2-enyl-2,3-dihydro-1H-indole.
| Compound Name | 5-fluoro-2-prop-2-enyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 119086663 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 5-fluoro-2-prop-2-enyl-2,3-dihydro-1H-indole |
| SMILES | C=CCC1Cc2cc(F)ccc2N1 |
| InChI | InChI=1S/C11H12FN/c1-2-3-10-7-8-6-9(12)4-5-11(8)13-10/h2,4-6,10,13H,1,3,7H2 |
| InChIKey | LCKLZPFTCDGXAJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|