C10H13FN2 — CID 82408944
(6-fluoro-1,2,3,4-tetrahydroquinolin-3-yl)methanamine (PubChem CID 82408944) has the molecular formula C10H13FN2 and a molecular weight of 180.23 g/mol. Its IUPAC name is (6-fluoro-1,2,3,4-tetrahydroquinolin-3-yl)methanamine.
| Compound Name | (6-fluoro-1,2,3,4-tetrahydroquinolin-3-yl)methanamine |
|---|---|
| PubChem CID | 82408944 |
| Molecular Formula | C10H13FN2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | (6-fluoro-1,2,3,4-tetrahydroquinolin-3-yl)methanamine |
| SMILES | NCC1CNc2ccc(F)cc2C1 |
| InChI | InChI=1S/C10H13FN2/c11-9-1-2-10-8(4-9)3-7(5-12)6-13-10/h1-2,4,7,13H,3,5-6,12H2 |
| InChIKey | RMZZERPHGSSNNS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |