C12H16FNO — CID 105463071
7-fluoro-3-(2-methoxyethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 105463071) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is 7-fluoro-3-(2-methoxyethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-fluoro-3-(2-methoxyethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 105463071 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 7-fluoro-3-(2-methoxyethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | COCCC1CNc2cc(F)ccc2C1 |
| InChI | InChI=1S/C12H16FNO/c1-15-5-4-9-6-10-2-3-11(13)7-12(10)14-8-9/h2-3,7,9,14H,4-6,8H2,1H3 |
| InChIKey | FDPDXZLCMNEVGQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |