C9H11ClFNO — CID 105455876
7-fluoro-1,2,3,4-tetrahydroquinolin-3-ol;hydrochloride (PubChem CID 105455876) has the molecular formula C9H11ClFNO and a molecular weight of 203.64 g/mol. Its IUPAC name is 7-fluoro-1,2,3,4-tetrahydroquinolin-3-ol;hydrochloride.
| Compound Name | 7-fluoro-1,2,3,4-tetrahydroquinolin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 105455876 |
| Molecular Formula | C9H11ClFNO |
| Molecular Weight | 203.64 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 7-fluoro-1,2,3,4-tetrahydroquinolin-3-ol;hydrochloride |
| SMILES | Cl.OC1CNc2cc(F)ccc2C1 |
| InChI | InChI=1S/C9H10FNO.ClH/c10-7-2-1-6-3-8(12)5-11-9(6)4-7;/h1-2,4,8,11-12H,3,5H2;1H |
| InChIKey | NNBMHJZJIKKWIS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.64 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |