C10H14ClNO2 — CID 105469275
6-methoxy-1,2,3,4-tetrahydroquinolin-3-ol;hydrochloride (PubChem CID 105469275) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is 6-methoxy-1,2,3,4-tetrahydroquinolin-3-ol;hydrochloride.
| Compound Name | 6-methoxy-1,2,3,4-tetrahydroquinolin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 105469275 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 6-methoxy-1,2,3,4-tetrahydroquinolin-3-ol;hydrochloride |
| SMILES | COc1ccc2c(c1)CC(O)CN2.Cl |
| InChI | InChI=1S/C10H13NO2.ClH/c1-13-9-2-3-10-7(5-9)4-8(12)6-11-10;/h2-3,5,8,11-12H,4,6H2,1H3;1H |
| InChIKey | DPBUDYYZQRGXDI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|