C17H19NO — CID 4046261
2-(2,4-dimethylphenyl)-5-methoxy-2,3-dihydro-1H-indole (PubChem CID 4046261) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-5-methoxy-2,3-dihydro-1H-indole.
| Compound Name | 2-(2,4-dimethylphenyl)-5-methoxy-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 4046261 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-5-methoxy-2,3-dihydro-1H-indole |
| SMILES | COc1ccc2c(c1)CC(c1ccc(C)cc1C)N2 |
| InChI | InChI=1S/C17H19NO/c1-11-4-6-15(12(2)8-11)17-10-13-9-14(19-3)5-7-16(13)18-17/h4-9,17-18H,10H2,1-3H3 |
| InChIKey | NOGHQFXOFCUBMK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|