C11H14N2O2 — CID 171252808
(4S)-4-(4-methoxy-2-methylphenyl)imidazolidin-2-one (PubChem CID 171252808) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is (4S)-4-(4-methoxy-2-methylphenyl)imidazolidin-2-one.
| Compound Name | (4S)-4-(4-methoxy-2-methylphenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 171252808 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (4S)-4-(4-methoxy-2-methylphenyl)imidazolidin-2-one |
| SMILES | COc1ccc([C@H]2CNC(=O)N2)c(C)c1 |
| InChI | InChI=1S/C11H14N2O2/c1-7-5-8(15-2)3-4-9(7)10-6-12-11(14)13-10/h3-5,10H,6H2,1-2H3,(H2,12,13,14)/t10-/m1/s1 |
| InChIKey | BCXWZTLGILUITG-SNVBAGLBSA-N |
| XLogP | 1.36 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |