C11H14N2O3 — CID 171252504
(4R)-4-(2,6-dimethoxyphenyl)imidazolidin-2-one (PubChem CID 171252504) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is (4R)-4-(2,6-dimethoxyphenyl)imidazolidin-2-one.
| Compound Name | (4R)-4-(2,6-dimethoxyphenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 171252504 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (4R)-4-(2,6-dimethoxyphenyl)imidazolidin-2-one |
| SMILES | COc1cccc(OC)c1[C@@H]1CNC(=O)N1 |
| InChI | InChI=1S/C11H14N2O3/c1-15-8-4-3-5-9(16-2)10(8)7-6-12-11(14)13-7/h3-5,7H,6H2,1-2H3,(H2,12,13,14)/t7-/m0/s1 |
| InChIKey | VWZNJMVQDHVGPW-ZETCQYMHSA-N |
| XLogP | 1.06 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |