C10H12N2O3 — CID 131302642
(4S)-4-(2-hydroxy-3-methoxyphenyl)imidazolidin-2-one (PubChem CID 131302642) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is (4S)-4-(2-hydroxy-3-methoxyphenyl)imidazolidin-2-one.
| Compound Name | (4S)-4-(2-hydroxy-3-methoxyphenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 131302642 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | (4S)-4-(2-hydroxy-3-methoxyphenyl)imidazolidin-2-one |
| SMILES | COc1cccc([C@H]2CNC(=O)N2)c1O |
| InChI | InChI=1S/C10H12N2O3/c1-15-8-4-2-3-6(9(8)13)7-5-11-10(14)12-7/h2-4,7,13H,5H2,1H3,(H2,11,12,14)/t7-/m1/s1 |
| InChIKey | FOKCMEOIIHYLLM-SSDOTTSWSA-N |
| XLogP | 0.75 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|