C12H14N2O4 — CID 171252600
[2-methoxy-4-[(4R)-2-oxoimidazolidin-4-yl]phenyl] acetate (PubChem CID 171252600) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is [2-methoxy-4-[(4R)-2-oxoimidazolidin-4-yl]phenyl] acetate.
| Compound Name | [2-methoxy-4-[(4R)-2-oxoimidazolidin-4-yl]phenyl] acetate |
|---|---|
| PubChem CID | 171252600 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | [2-methoxy-4-[(4R)-2-oxoimidazolidin-4-yl]phenyl] acetate |
| SMILES | COc1cc([C@@H]2CNC(=O)N2)ccc1OC(C)=O |
| InChI | InChI=1S/C12H14N2O4/c1-7(15)18-10-4-3-8(5-11(10)17-2)9-6-13-12(16)14-9/h3-5,9H,6H2,1-2H3,(H2,13,14,16)/t9-/m0/s1 |
| InChIKey | WCMQBYVPKOXBNN-VIFPVBQESA-N |
| XLogP | 0.97 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|