C14H18O5 — CID 154372128
[2-methoxy-4-(4-methyl-1,3-dioxan-2-yl)phenyl] acetate (PubChem CID 154372128) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is [2-methoxy-4-(4-methyl-1,3-dioxan-2-yl)phenyl] acetate.
| Compound Name | [2-methoxy-4-(4-methyl-1,3-dioxan-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 154372128 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | [2-methoxy-4-(4-methyl-1,3-dioxan-2-yl)phenyl] acetate |
| SMILES | COc1cc(C2OCCC(C)O2)ccc1OC(C)=O |
| InChI | InChI=1S/C14H18O5/c1-9-6-7-17-14(18-9)11-4-5-12(19-10(2)15)13(8-11)16-3/h4-5,8-9,14H,6-7H2,1-3H3 |
| InChIKey | PRESXARGMWYIPV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|