C12H13BrO5 — CID 170874264
[2-bromo-4-(1,3-dioxolan-2-yl)-6-methoxyphenyl] acetate (PubChem CID 170874264) has the molecular formula C12H13BrO5 and a molecular weight of 317.14 g/mol. Its IUPAC name is [2-bromo-4-(1,3-dioxolan-2-yl)-6-methoxyphenyl] acetate.
| Compound Name | [2-bromo-4-(1,3-dioxolan-2-yl)-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 170874264 |
| Molecular Formula | C12H13BrO5 |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | [2-bromo-4-(1,3-dioxolan-2-yl)-6-methoxyphenyl] acetate |
| SMILES | COc1cc(C2OCCO2)cc(Br)c1OC(C)=O |
| InChI | InChI=1S/C12H13BrO5/c1-7(14)18-11-9(13)5-8(6-10(11)15-2)12-16-3-4-17-12/h5-6,12H,3-4H2,1-2H3 |
| InChIKey | OWZRUOGAPMOSFH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|