C26H29BrO6 — CID 134107982
[2-bromo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl] acetate (PubChem CID 134107982) has the molecular formula C26H29BrO6 and a molecular weight of 517.42 g/mol. Its IUPAC name is [2-bromo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl] acetate.
| Compound Name | [2-bromo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl] acetate |
|---|---|
| PubChem CID | 134107982 |
| Molecular Formula | C26H29BrO6 |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | [2-bromo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl] acetate |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)cc(Br)c1OC(C)=O |
| InChI | InChI=1S/C26H29BrO6/c1-13(28)32-24-15(27)7-14(8-18(24)31-6)21-22-16(29)9-25(2,3)11-19(22)33-20-12-26(4,5)10-17(30)23(20)21/h7-8,21H,9-12H2,1-6H3 |
| InChIKey | JMJXHGVJZBMPMV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|