C25H29BrO5 — CID 1116006
9-(3-bromo-4,5-dimethoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 1116006) has the molecular formula C25H29BrO5 and a molecular weight of 489.41 g/mol. Its IUPAC name is 9-(3-bromo-4,5-dimethoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-(3-bromo-4,5-dimethoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 1116006 |
| Molecular Formula | C25H29BrO5 |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 9-(3-bromo-4,5-dimethoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)cc(Br)c1OC |
| InChI | InChI=1S/C25H29BrO5/c1-24(2)9-15(27)21-18(11-24)31-19-12-25(3,4)10-16(28)22(19)20(21)13-7-14(26)23(30-6)17(8-13)29-5/h7-8,20H,9-12H2,1-6H3 |
| InChIKey | KMSBGKSVWZKZOD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |