C34H38BrNO6 — CID 126274136
2-[2-bromo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(2,5-dimethylphenyl)acetamide (PubChem CID 126274136) has the molecular formula C34H38BrNO6 and a molecular weight of 636.58 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-[2-bromo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126274136 |
| Molecular Formula | C34H38BrNO6 |
| Molecular Weight | 636.58 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(2,5-dimethylphenyl)acetamide |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)cc(Br)c1OCC(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C34H38BrNO6/c1-18-8-9-19(2)22(10-18)36-28(39)17-41-32-21(35)11-20(12-25(32)40-7)29-30-23(37)13-33(3,4)15-26(30)42-27-16-34(5,6)14-24(38)31(27)29/h8-12,29H,13-17H2,1-7H3,(H,36,39) |
| InChIKey | YJFHXFLNKBQOEO-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.58 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |