C32H34BrNO5 — CID 126230441
2-[2-bromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126230441) has the molecular formula C32H34BrNO5 and a molecular weight of 592.53 g/mol. Its IUPAC name is 2-[2-bromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-bromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126230441 |
| Molecular Formula | C32H34BrNO5 |
| Molecular Weight | 592.53 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | 2-[2-bromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(C3C4=C(CC(C)(C)CC4=O)OC4=C3C(=O)CC(C)(C)C4)cc2Br)cc1 |
| InChI | InChI=1S/C32H34BrNO5/c1-18-6-9-20(10-7-18)34-27(37)17-38-24-11-8-19(12-21(24)33)28-29-22(35)13-31(2,3)15-25(29)39-26-16-32(4,5)14-23(36)30(26)28/h6-12,28H,13-17H2,1-5H3,(H,34,37) |
| InChIKey | JHUDNANDZSZMNR-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.53 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |