C33H36ClNO5 — CID 126277427
2-[2-chloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 126277427) has the molecular formula C33H36ClNO5 and a molecular weight of 562.11 g/mol. Its IUPAC name is 2-[2-chloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126277427 |
| Molecular Formula | C33H36ClNO5 |
| Molecular Weight | 562.11 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | 2-[2-chloro-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(C3C4=C(CC(C)(C)CC4=O)OC4=C3C(=O)CC(C)(C)C4)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C33H36ClNO5/c1-18-7-9-22(19(2)11-18)35-28(38)17-39-25-10-8-20(12-21(25)34)29-30-23(36)13-32(3,4)15-26(30)40-27-16-33(5,6)14-24(37)31(27)29/h7-12,29H,13-17H2,1-6H3,(H,35,38) |
| InChIKey | TWSNKHBNUCUSQB-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.11 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |