C40H42Cl2N2O4 — CID 126277147
2-[4-(10-benzyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2,6-dichlorophenoxy]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 126277147) has the molecular formula C40H42Cl2N2O4 and a molecular weight of 685.69 g/mol. Its IUPAC name is 2-[4-(10-benzyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2,6-dichlorophenoxy]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[4-(10-benzyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2,6-dichlorophenoxy]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126277147 |
| Molecular Formula | C40H42Cl2N2O4 |
| Molecular Weight | 685.69 g/mol |
| Exact Mass | 684.25 |
| IUPAC Name | 2-[4-(10-benzyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2,6-dichlorophenoxy]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2c(Cl)cc(C3C4=C(CC(C)(C)CC4=O)N(Cc4ccccc4)C4=C3C(=O)CC(C)(C)C4)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C40H42Cl2N2O4/c1-23-12-13-29(24(2)14-23)43-34(47)22-48-38-27(41)15-26(16-28(38)42)35-36-30(17-39(3,4)19-32(36)45)44(21-25-10-8-7-9-11-25)31-18-40(5,6)20-33(46)37(31)35/h7-16,35H,17-22H2,1-6H3,(H,43,47) |
| InChIKey | JBURHNHZFPRBRM-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.69 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |