C34H38Cl2N2O4 — CID 126265361
2-[2,6-dichloro-4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 126265361) has the molecular formula C34H38Cl2N2O4 and a molecular weight of 609.59 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2,6-dichloro-4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126265361 |
| Molecular Formula | C34H38Cl2N2O4 |
| Molecular Weight | 609.59 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | 2-[2,6-dichloro-4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | CCN1C2=C(C(=O)CC(C)(C)C2)C(c2cc(Cl)c(OCC(=O)Nc3cccc(C)c3)c(Cl)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C34H38Cl2N2O4/c1-7-38-24-14-33(3,4)16-26(39)30(24)29(31-25(38)15-34(5,6)17-27(31)40)20-12-22(35)32(23(36)13-20)42-18-28(41)37-21-10-8-9-19(2)11-21/h8-13,29H,7,14-18H2,1-6H3,(H,37,41) |
| InChIKey | XCOBBJRDOMKRHJ-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.59 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |