C31H33ClN2O5 — CID 1006854
2-[2-chloro-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-6-methoxyphenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 1006854) has the molecular formula C31H33ClN2O5 and a molecular weight of 549.07 g/mol. Its IUPAC name is 2-[2-chloro-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-6-methoxyphenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-6-methoxyphenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 1006854 |
| Molecular Formula | C31H33ClN2O5 |
| Molecular Weight | 549.07 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 2-[2-chloro-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-6-methoxyphenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | CCN1C2=C(C(=O)CCC2)C(c2cc(Cl)c(OCC(=O)Nc3cccc(C)c3)c(OC)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C31H33ClN2O5/c1-4-34-22-10-6-12-24(35)29(22)28(30-23(34)11-7-13-25(30)36)19-15-21(32)31(26(16-19)38-3)39-17-27(37)33-20-9-5-8-18(2)14-20/h5,8-9,14-16,28H,4,6-7,10-13,17H2,1-3H3,(H,33,37) |
| InChIKey | HZTGDRGEENKWMR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.07 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |