C31H32Cl2N2O4 — CID 126270664
2-[2,6-dichloro-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 126270664) has the molecular formula C31H32Cl2N2O4 and a molecular weight of 567.51 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[2,6-dichloro-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126270664 |
| Molecular Formula | C31H32Cl2N2O4 |
| Molecular Weight | 567.51 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | 2-[2,6-dichloro-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | CCN1C2=C(C(=O)CCC2)C(c2cc(Cl)c(OCC(=O)Nc3ccc(C)c(C)c3)c(Cl)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C31H32Cl2N2O4/c1-4-35-23-7-5-9-25(36)29(23)28(30-24(35)8-6-10-26(30)37)19-14-21(32)31(22(33)15-19)39-16-27(38)34-20-12-11-17(2)18(3)13-20/h11-15,28H,4-10,16H2,1-3H3,(H,34,38) |
| InChIKey | LQFDVNLNTKZKAP-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.51 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |