C30H30Cl2N2O4 — CID 126263933
2-[2,6-dichloro-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 126263933) has the molecular formula C30H30Cl2N2O4 and a molecular weight of 553.49 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[2,6-dichloro-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126263933 |
| Molecular Formula | C30H30Cl2N2O4 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | 2-[2,6-dichloro-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)COc2c(Cl)cc(C3C4=C(CCCC4=O)N(C)C4=C3C(=O)CCC4)cc2Cl)c1C |
| InChI | InChI=1S/C30H30Cl2N2O4/c1-16-7-4-8-21(17(16)2)33-26(37)15-38-30-19(31)13-18(14-20(30)32)27-28-22(9-5-11-24(28)35)34(3)23-10-6-12-25(36)29(23)27/h4,7-8,13-14,27H,5-6,9-12,15H2,1-3H3,(H,33,37) |
| InChIKey | SDAPPXUKWYQXFB-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |