C28H26BrClN2O4 — CID 126255641
2-[2-bromo-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(2-chlorophenyl)acetamide (PubChem CID 126255641) has the molecular formula C28H26BrClN2O4 and a molecular weight of 569.88 g/mol. Its IUPAC name is 2-[2-bromo-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[2-bromo-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126255641 |
| Molecular Formula | C28H26BrClN2O4 |
| Molecular Weight | 569.88 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | 2-[2-bromo-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(2-chlorophenyl)acetamide |
| SMILES | CN1C2=C(C(=O)CCC2)C(c2ccc(OCC(=O)Nc3ccccc3Cl)c(Br)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C28H26BrClN2O4/c1-32-20-8-4-10-22(33)27(20)26(28-21(32)9-5-11-23(28)34)16-12-13-24(17(29)14-16)36-15-25(35)31-19-7-3-2-6-18(19)30/h2-3,6-7,12-14,26H,4-5,8-11,15H2,1H3,(H,31,35) |
| InChIKey | IPGBLAPJYVONGW-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.88 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |