C30H31FN2O5 — CID 126390665
2-[4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-2-methoxyphenoxy]-N-(2-fluorophenyl)acetamide (PubChem CID 126390665) has the molecular formula C30H31FN2O5 and a molecular weight of 518.59 g/mol. Its IUPAC name is 2-[4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-2-methoxyphenoxy]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-2-methoxyphenoxy]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126390665 |
| Molecular Formula | C30H31FN2O5 |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 2-[4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-2-methoxyphenoxy]-N-(2-fluorophenyl)acetamide |
| SMILES | CCN1C2=C(C(=O)CCC2)C(c2ccc(OCC(=O)Nc3ccccc3F)c(OC)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C30H31FN2O5/c1-3-33-21-10-6-12-23(34)29(21)28(30-22(33)11-7-13-24(30)35)18-14-15-25(26(16-18)37-2)38-17-27(36)32-20-9-5-4-8-19(20)31/h4-5,8-9,14-16,28H,3,6-7,10-13,17H2,1-2H3,(H,32,36) |
| InChIKey | LCDFMFKFXFLXQY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |