C29H28BrClN2O4 — CID 126231423
2-[2-bromo-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(4-chlorophenyl)acetamide (PubChem CID 126231423) has the molecular formula C29H28BrClN2O4 and a molecular weight of 583.91 g/mol. Its IUPAC name is 2-[2-bromo-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[2-bromo-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126231423 |
| Molecular Formula | C29H28BrClN2O4 |
| Molecular Weight | 583.91 g/mol |
| Exact Mass | 582.09 |
| IUPAC Name | 2-[2-bromo-4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]-N-(4-chlorophenyl)acetamide |
| SMILES | CCN1C2=C(C(=O)CCC2)C(c2ccc(OCC(=O)Nc3ccc(Cl)cc3)c(Br)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C29H28BrClN2O4/c1-2-33-21-5-3-7-23(34)28(21)27(29-22(33)6-4-8-24(29)35)17-9-14-25(20(30)15-17)37-16-26(36)32-19-12-10-18(31)11-13-19/h9-15,27H,2-8,16H2,1H3,(H,32,36) |
| InChIKey | MDOITJFSVHGCIH-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.91 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |