C29H27Br2ClN2O4 — CID 126279084
N-(4-chlorophenyl)-2-[2,4-dibromo-6-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]acetamide (PubChem CID 126279084) has the molecular formula C29H27Br2ClN2O4 and a molecular weight of 662.81 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2,4-dibromo-6-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[2,4-dibromo-6-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126279084 |
| Molecular Formula | C29H27Br2ClN2O4 |
| Molecular Weight | 662.81 g/mol |
| Exact Mass | 660.00 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2,4-dibromo-6-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenoxy]acetamide |
| SMILES | CCN1C2=C(C(=O)CCC2)C(c2cc(Br)cc(Br)c2OCC(=O)Nc2ccc(Cl)cc2)C2=C1CCCC2=O |
| InChI | InChI=1S/C29H27Br2ClN2O4/c1-2-34-21-5-3-7-23(35)27(21)26(28-22(34)6-4-8-24(28)36)19-13-16(30)14-20(31)29(19)38-15-25(37)33-18-11-9-17(32)10-12-18/h9-14,26H,2-8,15H2,1H3,(H,33,37) |
| InChIKey | UHOOALDCGSYIHZ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.81 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |