C27H23Br2NO5 — CID 126267362
2-[2,4-dibromo-6-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]-N-phenylacetamide (PubChem CID 126267362) has the molecular formula C27H23Br2NO5 and a molecular weight of 601.29 g/mol. Its IUPAC name is 2-[2,4-dibromo-6-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2,4-dibromo-6-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126267362 |
| Molecular Formula | C27H23Br2NO5 |
| Molecular Weight | 601.29 g/mol |
| Exact Mass | 598.99 |
| IUPAC Name | 2-[2,4-dibromo-6-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1c(Br)cc(Br)cc1C1C2=C(CCCC2=O)OC2=C1C(=O)CCC2)Nc1ccccc1 |
| InChI | InChI=1S/C27H23Br2NO5/c28-15-12-17(27(18(29)13-15)34-14-23(33)30-16-6-2-1-3-7-16)24-25-19(31)8-4-10-21(25)35-22-11-5-9-20(32)26(22)24/h1-3,6-7,12-13,24H,4-5,8-11,14H2,(H,30,33) |
| InChIKey | BTQKJUJRPQYIGU-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.29 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |