C33H35Br2NO5 — CID 126258777
2-[2,4-dibromo-6-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(2,5-dimethylphenyl)acetamide (PubChem CID 126258777) has the molecular formula C33H35Br2NO5 and a molecular weight of 685.45 g/mol. Its IUPAC name is 2-[2,4-dibromo-6-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-[2,4-dibromo-6-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126258777 |
| Molecular Formula | C33H35Br2NO5 |
| Molecular Weight | 685.45 g/mol |
| Exact Mass | 683.09 |
| IUPAC Name | 2-[2,4-dibromo-6-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]-N-(2,5-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)COc2c(Br)cc(Br)cc2C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)c1 |
| InChI | InChI=1S/C33H35Br2NO5/c1-17-7-8-18(2)22(9-17)36-27(39)16-40-31-20(10-19(34)11-21(31)35)28-29-23(37)12-32(3,4)14-25(29)41-26-15-33(5,6)13-24(38)30(26)28/h7-11,28H,12-16H2,1-6H3,(H,36,39) |
| InChIKey | UDHCHLGVQMYWJV-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.45 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |