C30H29Br2ClO4 — CID 124598385
9-[3,5-dibromo-2-[(4-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 124598385) has the molecular formula C30H29Br2ClO4 and a molecular weight of 648.82 g/mol. Its IUPAC name is 9-[3,5-dibromo-2-[(4-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-[3,5-dibromo-2-[(4-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 124598385 |
| Molecular Formula | C30H29Br2ClO4 |
| Molecular Weight | 648.82 g/mol |
| Exact Mass | 646.01 |
| IUPAC Name | 9-[3,5-dibromo-2-[(4-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1=C(C(=O)CC(C)(C)C1)C2c1cc(Br)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H29Br2ClO4/c1-29(2)11-21(34)26-23(13-29)37-24-14-30(3,4)12-22(35)27(24)25(26)19-9-17(31)10-20(32)28(19)36-15-16-5-7-18(33)8-6-16/h5-10,25H,11-15H2,1-4H3 |
| InChIKey | BHGUXAJBPGOWIS-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.82 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |