C32H32Br2ClNO5 — CID 126056657
2-[9-[3,5-dibromo-2-[(4-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid (PubChem CID 126056657) has the molecular formula C32H32Br2ClNO5 and a molecular weight of 705.87 g/mol. Its IUPAC name is 2-[9-[3,5-dibromo-2-[(4-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-[3,5-dibromo-2-[(4-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 126056657 |
| Molecular Formula | C32H32Br2ClNO5 |
| Molecular Weight | 705.87 g/mol |
| Exact Mass | 703.03 |
| IUPAC Name | 2-[9-[3,5-dibromo-2-[(4-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(CC(=O)O)C1=C(C(=O)CC(C)(C)C1)C2c1cc(Br)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H32Br2ClNO5/c1-31(2)11-22-28(24(37)13-31)27(29-23(36(22)15-26(39)40)12-32(3,4)14-25(29)38)20-9-18(33)10-21(34)30(20)41-16-17-5-7-19(35)8-6-17/h5-10,27H,11-16H2,1-4H3,(H,39,40) |
| InChIKey | SVBNWWHYQCZGME-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.87 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |