C27H33Br2NO3 — CID 126056328
9-(3,5-dibromo-2-ethoxyphenyl)-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126056328) has the molecular formula C27H33Br2NO3 and a molecular weight of 579.37 g/mol. Its IUPAC name is 9-(3,5-dibromo-2-ethoxyphenyl)-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(3,5-dibromo-2-ethoxyphenyl)-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126056328 |
| Molecular Formula | C27H33Br2NO3 |
| Molecular Weight | 579.37 g/mol |
| Exact Mass | 577.08 |
| IUPAC Name | 9-(3,5-dibromo-2-ethoxyphenyl)-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CCOc1c(Br)cc(Br)cc1C1C2=C(CC(C)(C)CC2=O)N(CC)C2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C27H33Br2NO3/c1-7-30-18-11-26(3,4)13-20(31)23(18)22(24-19(30)12-27(5,6)14-21(24)32)16-9-15(28)10-17(29)25(16)33-8-2/h9-10,22H,7-8,11-14H2,1-6H3 |
| InChIKey | YPQHVQMWMRAPKI-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.37 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |