C27H29Br2NO3 — CID 126053215
9-(3,5-dibromo-2-prop-2-ynoxyphenyl)-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126053215) has the molecular formula C27H29Br2NO3 and a molecular weight of 575.34 g/mol. Its IUPAC name is 9-(3,5-dibromo-2-prop-2-ynoxyphenyl)-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(3,5-dibromo-2-prop-2-ynoxyphenyl)-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126053215 |
| Molecular Formula | C27H29Br2NO3 |
| Molecular Weight | 575.34 g/mol |
| Exact Mass | 573.05 |
| IUPAC Name | 9-(3,5-dibromo-2-prop-2-ynoxyphenyl)-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | C#CCOc1c(Br)cc(Br)cc1C1C2=C(CC(C)(C)CC2=O)N(C)C2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C27H29Br2NO3/c1-7-8-33-25-16(9-15(28)10-17(25)29)22-23-18(11-26(2,3)13-20(23)31)30(6)19-12-27(4,5)14-21(32)24(19)22/h1,9-10,22H,8,11-14H2,2-6H3 |
| InChIKey | MEWWLXDGVOQYCJ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.34 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|