C26H33NO3 — CID 1072569
9-(2-ethoxyphenyl)-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 1072569) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is 9-(2-ethoxyphenyl)-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(2-ethoxyphenyl)-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 1072569 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 9-(2-ethoxyphenyl)-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CCOc1ccccc1C1C2=C(CC(C)(C)CC2=O)N(C)C2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C26H33NO3/c1-7-30-21-11-9-8-10-16(21)22-23-17(12-25(2,3)14-19(23)28)27(6)18-13-26(4,5)15-20(29)24(18)22/h8-11,22H,7,12-15H2,1-6H3 |
| InChIKey | GVBVMBVQZNQDHS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |