C31H35NO4 — CID 1362259
9-(2-methoxyphenyl)-10-(4-methoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 1362259) has the molecular formula C31H35NO4 and a molecular weight of 485.62 g/mol. Its IUPAC name is 9-(2-methoxyphenyl)-10-(4-methoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(2-methoxyphenyl)-10-(4-methoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 1362259 |
| Molecular Formula | C31H35NO4 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | 9-(2-methoxyphenyl)-10-(4-methoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | COc1ccc(N2C3=C(C(=O)CC(C)(C)C3)C(c3ccccc3OC)C3=C2CC(C)(C)CC3=O)cc1 |
| InChI | InChI=1S/C31H35NO4/c1-30(2)15-22-28(24(33)17-30)27(21-9-7-8-10-26(21)36-6)29-23(16-31(3,4)18-25(29)34)32(22)19-11-13-20(35-5)14-12-19/h7-14,27H,15-18H2,1-6H3 |
| InChIKey | JQMTUFBVPVQBCP-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |