C33H34N2O5 — CID 135734466
(3E)-1-(2,5-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(2-methoxyphenyl)-7,7-dimethyl-6,8-dihydro-4H-quinolin-5-one (PubChem CID 135734466) has the molecular formula C33H34N2O5 and a molecular weight of 538.64 g/mol. Its IUPAC name is (3E)-1-(2,5-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(2-methoxyphenyl)-7,7-dimethyl-6,8-dihydro-4H-quinolin-5-one.
| Compound Name | (3E)-1-(2,5-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(2-methoxyphenyl)-7,7-dimethyl-6,8-dihydro-4H-quinolin-5-one |
|---|---|
| PubChem CID | 135734466 |
| Molecular Formula | C33H34N2O5 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | (3E)-1-(2,5-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(2-methoxyphenyl)-7,7-dimethyl-6,8-dihydro-4H-quinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccccc2)/C(c2ccccc2OC)C2=C(CC(C)(C)CC2=O)N/1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C33H34N2O5/c1-33(2)18-24-29(25(36)19-33)28(22-13-9-10-14-26(22)39-4)30(31(37)20-11-7-6-8-12-20)32(34)35(24)23-17-21(38-3)15-16-27(23)40-5/h6-17,28,34,37H,18-19H2,1-5H3/b31-30+,34-32- |
| InChIKey | RWQKRFZCVUNQFK-YRWJTWMZSA-N |
| XLogP | 6.91 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|