C35H37N3O8 — CID 135673908
(3E,4S)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-imino-7,7-dimethyl-1-(2-methyl-5-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)-6,8-dihydro-4H-quinolin-5-one (PubChem CID 135673908) has the molecular formula C35H37N3O8 and a molecular weight of 627.69 g/mol. Its IUPAC name is (3E,4S)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-imino-7,7-dimethyl-1-(2-methyl-5-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)-6,8-dihydro-4H-quinolin-5-one.
| Compound Name | (3E,4S)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-imino-7,7-dimethyl-1-(2-methyl-5-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)-6,8-dihydro-4H-quinolin-5-one |
|---|---|
| PubChem CID | 135673908 |
| Molecular Formula | C35H37N3O8 |
| Molecular Weight | 627.69 g/mol |
| Exact Mass | 627.26 |
| IUPAC Name | (3E,4S)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-imino-7,7-dimethyl-1-(2-methyl-5-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)-6,8-dihydro-4H-quinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(OC)cc2)/[C@H](c2cc(OC)c(OC)c(OC)c2)C2=C(CC(C)(C)CC2=O)N/1c1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C35H37N3O8/c1-19-8-11-22(38(41)42)16-24(19)37-25-17-35(2,3)18-26(39)30(25)29(21-14-27(44-5)33(46-7)28(15-21)45-6)31(34(37)36)32(40)20-9-12-23(43-4)13-10-20/h8-16,29,36,40H,17-18H2,1-7H3/b32-31+,36-34-/t29-/m1/s1 |
| InChIKey | SSUOPQKASXLBPX-IIPJNASSSA-N |
| XLogP | 7.13 |
| TPSA | 144.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.69 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|