C33H33N3O8 — CID 135420277
(3E)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-imino-1-(2-methyl-5-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 135420277) has the molecular formula C33H33N3O8 and a molecular weight of 599.64 g/mol. Its IUPAC name is (3E)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-imino-1-(2-methyl-5-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (3E)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-imino-1-(2-methyl-5-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 135420277 |
| Molecular Formula | C33H33N3O8 |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | (3E)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-imino-1-(2-methyl-5-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(OC)cc2)/C(c2cc(OC)c(OC)c(OC)c2)C2=C(CCCC2=O)N/1c1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C33H33N3O8/c1-18-9-12-21(36(39)40)17-24(18)35-23-7-6-8-25(37)29(23)28(20-15-26(42-3)32(44-5)27(16-20)43-4)30(33(35)34)31(38)19-10-13-22(41-2)14-11-19/h9-17,28,34,38H,6-8H2,1-5H3/b31-30+,34-33- |
| InChIKey | JIEYULLQPRSUAH-ZPRKJMLDSA-N |
| XLogP | 6.50 |
| TPSA | 144.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|