C31H28N2O6 — CID 136768019
(4R)-4-(1,3-benzodioxol-5-yl)-1-(2,5-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 136768019) has the molecular formula C31H28N2O6 and a molecular weight of 524.57 g/mol. Its IUPAC name is (4R)-4-(1,3-benzodioxol-5-yl)-1-(2,5-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (4R)-4-(1,3-benzodioxol-5-yl)-1-(2,5-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 136768019 |
| Molecular Formula | C31H28N2O6 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | (4R)-4-(1,3-benzodioxol-5-yl)-1-(2,5-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1/C(=C(O)c2ccccc2)[C@@H](c2ccc3c(c2)OCO3)C2=C(CCCC2=O)N1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C31H28N2O6/c1-36-20-12-14-24(37-2)22(16-20)33-21-9-6-10-23(34)28(21)27(19-11-13-25-26(15-19)39-17-38-25)29(31(33)32)30(35)18-7-4-3-5-8-18/h3-5,7-8,11-16,27,32,35H,6,9-10,17H2,1-2H3/b30-29?,32-31-/t27-/m0/s1 |
| InChIKey | UJEZSDBMMRZUGB-BOQVILKSSA-N |
| XLogP | 5.99 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|