C29H25ClN2O3 — CID 136868591
(4S)-1-(4-chlorophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(4-methoxyphenyl)-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 136868591) has the molecular formula C29H25ClN2O3 and a molecular weight of 484.98 g/mol. Its IUPAC name is (4S)-1-(4-chlorophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(4-methoxyphenyl)-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (4S)-1-(4-chlorophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(4-methoxyphenyl)-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 136868591 |
| Molecular Formula | C29H25ClN2O3 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (4S)-1-(4-chlorophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(4-methoxyphenyl)-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1/C(=C(O)c2ccccc2)[C@H](c2ccc(OC)cc2)C2=C(CCCC2=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H25ClN2O3/c1-35-22-16-10-18(11-17-22)25-26-23(8-5-9-24(26)33)32(21-14-12-20(30)13-15-21)29(31)27(25)28(34)19-6-3-2-4-7-19/h2-4,6-7,10-17,25,31,34H,5,8-9H2,1H3/b28-27?,31-29-/t25-/m1/s1 |
| InChIKey | HMCKCMHHXDRIGY-QMNXJWPASA-N |
| XLogP | 6.91 |
| TPSA | 73.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|