C29H23ClN2O4 — CID 135697777
(3E,4S)-4-(1,3-benzodioxol-5-yl)-1-(4-chlorophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 135697777) has the molecular formula C29H23ClN2O4 and a molecular weight of 498.97 g/mol. Its IUPAC name is (3E,4S)-4-(1,3-benzodioxol-5-yl)-1-(4-chlorophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (3E,4S)-4-(1,3-benzodioxol-5-yl)-1-(4-chlorophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 135697777 |
| Molecular Formula | C29H23ClN2O4 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | (3E,4S)-4-(1,3-benzodioxol-5-yl)-1-(4-chlorophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccccc2)/[C@H](c2ccc3c(c2)OCO3)C2=C(CCCC2=O)N/1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H23ClN2O4/c30-19-10-12-20(13-11-19)32-21-7-4-8-22(33)26(21)25(18-9-14-23-24(15-18)36-16-35-23)27(29(32)31)28(34)17-5-2-1-3-6-17/h1-3,5-6,9-15,25,31,34H,4,7-8,16H2/b28-27+,31-29-/t25-/m1/s1 |
| InChIKey | KJTRUMITDSZOKM-LJGUOHOWSA-N |
| XLogP | 6.63 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|