C30H27ClN2O2S — CID 135837595
(3E)-1-(3-chloro-4-methylphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(4-methylsulfanylphenyl)-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 135837595) has the molecular formula C30H27ClN2O2S and a molecular weight of 515.08 g/mol. Its IUPAC name is (3E)-1-(3-chloro-4-methylphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(4-methylsulfanylphenyl)-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (3E)-1-(3-chloro-4-methylphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(4-methylsulfanylphenyl)-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 135837595 |
| Molecular Formula | C30H27ClN2O2S |
| Molecular Weight | 515.08 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | (3E)-1-(3-chloro-4-methylphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(4-methylsulfanylphenyl)-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccccc2)/C(c2ccc(SC)cc2)C2=C(CCCC2=O)N/1c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C30H27ClN2O2S/c1-18-11-14-21(17-23(18)31)33-24-9-6-10-25(34)27(24)26(19-12-15-22(36-2)16-13-19)28(30(33)32)29(35)20-7-4-3-5-8-20/h3-5,7-8,11-17,26,32,35H,6,9-10H2,1-2H3/b29-28+,32-30- |
| InChIKey | JBBHZIOJIBZHGB-JUSAUZGOSA-N |
| XLogP | 7.93 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.08 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|