C29H24ClN3O4 — CID 135494625
(3E)-1-(3-chloro-4-methylphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(4-nitrophenyl)-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 135494625) has the molecular formula C29H24ClN3O4 and a molecular weight of 513.98 g/mol. Its IUPAC name is (3E)-1-(3-chloro-4-methylphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(4-nitrophenyl)-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (3E)-1-(3-chloro-4-methylphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(4-nitrophenyl)-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 135494625 |
| Molecular Formula | C29H24ClN3O4 |
| Molecular Weight | 513.98 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | (3E)-1-(3-chloro-4-methylphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(4-nitrophenyl)-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccccc2)/C(c2ccc([N+](=O)[O-])cc2)C2=C(CCCC2=O)N/1c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C29H24ClN3O4/c1-17-10-13-21(16-22(17)30)32-23-8-5-9-24(34)26(23)25(18-11-14-20(15-12-18)33(36)37)27(29(32)31)28(35)19-6-3-2-4-7-19/h2-4,6-7,10-16,25,31,35H,5,8-9H2,1H3/b28-27+,31-29- |
| InChIKey | NADBPBUUBBYXEX-OGVAXNNSSA-N |
| XLogP | 7.11 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.98 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|