C30H27N3O5 — CID 136897352
(4R)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-(4-methoxyphenyl)-1-(4-nitrophenyl)-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 136897352) has the molecular formula C30H27N3O5 and a molecular weight of 509.56 g/mol. Its IUPAC name is (4R)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-(4-methoxyphenyl)-1-(4-nitrophenyl)-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (4R)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-(4-methoxyphenyl)-1-(4-nitrophenyl)-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 136897352 |
| Molecular Formula | C30H27N3O5 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | (4R)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-4-(4-methoxyphenyl)-1-(4-nitrophenyl)-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1/C(=C(O)c2ccc(C)cc2)[C@@H](c2ccc(OC)cc2)C2=C(CCCC2=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H27N3O5/c1-18-6-8-20(9-7-18)29(35)28-26(19-10-16-23(38-2)17-11-19)27-24(4-3-5-25(27)34)32(30(28)31)21-12-14-22(15-13-21)33(36)37/h6-17,26,31,35H,3-5H2,1-2H3/b29-28?,31-30-/t26-/m0/s1 |
| InChIKey | ASORLOUDZRTZQE-JYGOVJKDSA-N |
| XLogP | 6.47 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|