C31H29N3O6 — CID 135420238
(3E)-4-(2,5-dimethoxyphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-1-(4-nitrophenyl)-4,6,7,8-tetrahydroquinolin-5-one (PubChem CID 135420238) has the molecular formula C31H29N3O6 and a molecular weight of 539.59 g/mol. Its IUPAC name is (3E)-4-(2,5-dimethoxyphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-1-(4-nitrophenyl)-4,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (3E)-4-(2,5-dimethoxyphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-1-(4-nitrophenyl)-4,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 135420238 |
| Molecular Formula | C31H29N3O6 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | (3E)-4-(2,5-dimethoxyphenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-1-(4-nitrophenyl)-4,6,7,8-tetrahydroquinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(C)cc2)/C(c2cc(OC)ccc2OC)C2=C(CCCC2=O)N/1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H29N3O6/c1-18-7-9-19(10-8-18)30(36)29-27(23-17-22(39-2)15-16-26(23)40-3)28-24(5-4-6-25(28)35)33(31(29)32)20-11-13-21(14-12-20)34(37)38/h7-17,27,32,36H,4-6H2,1-3H3/b30-29+,32-31- |
| InChIKey | SPJZXEYJQOZATE-PXNGOMMCSA-N |
| XLogP | 6.48 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|