C33H33ClN2O4 — CID 136868611
(4R)-1-(3-chloro-4-methylphenyl)-4-(2,5-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-7,7-dimethyl-6,8-dihydro-4H-quinolin-5-one (PubChem CID 136868611) has the molecular formula C33H33ClN2O4 and a molecular weight of 557.09 g/mol. Its IUPAC name is (4R)-1-(3-chloro-4-methylphenyl)-4-(2,5-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-7,7-dimethyl-6,8-dihydro-4H-quinolin-5-one.
| Compound Name | (4R)-1-(3-chloro-4-methylphenyl)-4-(2,5-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-7,7-dimethyl-6,8-dihydro-4H-quinolin-5-one |
|---|---|
| PubChem CID | 136868611 |
| Molecular Formula | C33H33ClN2O4 |
| Molecular Weight | 557.09 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | (4R)-1-(3-chloro-4-methylphenyl)-4-(2,5-dimethoxyphenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-7,7-dimethyl-6,8-dihydro-4H-quinolin-5-one |
| SMILES | [H]/N=C1/C(=C(O)c2ccccc2)[C@@H](c2cc(OC)ccc2OC)C2=C(CC(C)(C)CC2=O)N1c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C33H33ClN2O4/c1-19-11-12-21(15-24(19)34)36-25-17-33(2,3)18-26(37)29(25)28(23-16-22(39-4)13-14-27(23)40-5)30(32(36)35)31(38)20-9-7-6-8-10-20/h6-16,28,35,38H,17-18H2,1-5H3/b31-30?,35-32-/t28-/m0/s1 |
| InChIKey | IOPBLNYOIPXTAO-VMSJKEEPSA-N |
| XLogP | 7.86 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.09 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|