C31H29BrN2O3 — CID 136868587
(4R)-1-(4-bromophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(4-methoxyphenyl)-7,7-dimethyl-6,8-dihydro-4H-quinolin-5-one (PubChem CID 136868587) has the molecular formula C31H29BrN2O3 and a molecular weight of 557.49 g/mol. Its IUPAC name is (4R)-1-(4-bromophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(4-methoxyphenyl)-7,7-dimethyl-6,8-dihydro-4H-quinolin-5-one.
| Compound Name | (4R)-1-(4-bromophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(4-methoxyphenyl)-7,7-dimethyl-6,8-dihydro-4H-quinolin-5-one |
|---|---|
| PubChem CID | 136868587 |
| Molecular Formula | C31H29BrN2O3 |
| Molecular Weight | 557.49 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | (4R)-1-(4-bromophenyl)-3-[hydroxy(phenyl)methylidene]-2-imino-4-(4-methoxyphenyl)-7,7-dimethyl-6,8-dihydro-4H-quinolin-5-one |
| SMILES | [H]/N=C1/C(=C(O)c2ccccc2)[C@@H](c2ccc(OC)cc2)C2=C(CC(C)(C)CC2=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C31H29BrN2O3/c1-31(2)17-24-27(25(35)18-31)26(19-9-15-23(37-3)16-10-19)28(29(36)20-7-5-4-6-8-20)30(33)34(24)22-13-11-21(32)12-14-22/h4-16,26,33,36H,17-18H2,1-3H3/b29-28?,33-30-/t26-/m0/s1 |
| InChIKey | AAZXHRUXGQGEGL-ZRNXHVHMSA-N |
| XLogP | 7.65 |
| TPSA | 73.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.49 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|