C31H30N2O2 — CID 136868573
(4S)-3-[hydroxy(phenyl)methylidene]-2-imino-7,7-dimethyl-4-(4-methylphenyl)-1-phenyl-6,8-dihydro-4H-quinolin-5-one (PubChem CID 136868573) has the molecular formula C31H30N2O2 and a molecular weight of 462.59 g/mol. Its IUPAC name is (4S)-3-[hydroxy(phenyl)methylidene]-2-imino-7,7-dimethyl-4-(4-methylphenyl)-1-phenyl-6,8-dihydro-4H-quinolin-5-one.
| Compound Name | (4S)-3-[hydroxy(phenyl)methylidene]-2-imino-7,7-dimethyl-4-(4-methylphenyl)-1-phenyl-6,8-dihydro-4H-quinolin-5-one |
|---|---|
| PubChem CID | 136868573 |
| Molecular Formula | C31H30N2O2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | (4S)-3-[hydroxy(phenyl)methylidene]-2-imino-7,7-dimethyl-4-(4-methylphenyl)-1-phenyl-6,8-dihydro-4H-quinolin-5-one |
| SMILES | [H]/N=C1/C(=C(O)c2ccccc2)[C@H](c2ccc(C)cc2)C2=C(CC(C)(C)CC2=O)N1c1ccccc1 |
| InChI | InChI=1S/C31H30N2O2/c1-20-14-16-21(17-15-20)26-27-24(18-31(2,3)19-25(27)34)33(23-12-8-5-9-13-23)30(32)28(26)29(35)22-10-6-4-7-11-22/h4-17,26,32,35H,18-19H2,1-3H3/b29-28?,32-30-/t26-/m1/s1 |
| InChIKey | JOQDIRJNYZTIKE-IABORDRTSA-N |
| XLogP | 7.19 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|