C30H29N3O2S — CID 135627196
(3E,4R)-3-[hydroxy(phenyl)methylidene]-2-imino-7,7-dimethyl-4-(4-methylsulfanylphenyl)-1-pyridin-3-yl-6,8-dihydro-4H-quinolin-5-one (PubChem CID 135627196) has the molecular formula C30H29N3O2S and a molecular weight of 495.65 g/mol. Its IUPAC name is (3E,4R)-3-[hydroxy(phenyl)methylidene]-2-imino-7,7-dimethyl-4-(4-methylsulfanylphenyl)-1-pyridin-3-yl-6,8-dihydro-4H-quinolin-5-one.
| Compound Name | (3E,4R)-3-[hydroxy(phenyl)methylidene]-2-imino-7,7-dimethyl-4-(4-methylsulfanylphenyl)-1-pyridin-3-yl-6,8-dihydro-4H-quinolin-5-one |
|---|---|
| PubChem CID | 135627196 |
| Molecular Formula | C30H29N3O2S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | (3E,4R)-3-[hydroxy(phenyl)methylidene]-2-imino-7,7-dimethyl-4-(4-methylsulfanylphenyl)-1-pyridin-3-yl-6,8-dihydro-4H-quinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccccc2)/[C@@H](c2ccc(SC)cc2)C2=C(CC(C)(C)CC2=O)N/1c1cccnc1 |
| InChI | InChI=1S/C30H29N3O2S/c1-30(2)16-23-26(24(34)17-30)25(19-11-13-22(36-3)14-12-19)27(28(35)20-8-5-4-6-9-20)29(31)33(23)21-10-7-15-32-18-21/h4-15,18,25,31,35H,16-17H2,1-3H3/b28-27+,31-29-/t25-/m0/s1 |
| InChIKey | YPBYTWLIRSKTBU-GLBXYWRQSA-N |
| XLogP | 7.00 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|