C30H28BrN3O2 — CID 135598322
(3E)-1-(3-bromophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-4-pyridin-3-yl-6,8-dihydro-4H-quinolin-5-one (PubChem CID 135598322) has the molecular formula C30H28BrN3O2 and a molecular weight of 542.48 g/mol. Its IUPAC name is (3E)-1-(3-bromophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-4-pyridin-3-yl-6,8-dihydro-4H-quinolin-5-one.
| Compound Name | (3E)-1-(3-bromophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-4-pyridin-3-yl-6,8-dihydro-4H-quinolin-5-one |
|---|---|
| PubChem CID | 135598322 |
| Molecular Formula | C30H28BrN3O2 |
| Molecular Weight | 542.48 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | (3E)-1-(3-bromophenyl)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-4-pyridin-3-yl-6,8-dihydro-4H-quinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(C)cc2)/C(c2cccnc2)C2=C(CC(C)(C)CC2=O)N/1c1cccc(Br)c1 |
| InChI | InChI=1S/C30H28BrN3O2/c1-18-9-11-19(12-10-18)28(36)27-25(20-6-5-13-33-17-20)26-23(15-30(2,3)16-24(26)35)34(29(27)32)22-8-4-7-21(31)14-22/h4-14,17,25,32,36H,15-16H2,1-3H3/b28-27+,32-29- |
| InChIKey | MCVRJIWZXOXZDF-JMGIWBCSSA-N |
| XLogP | 7.35 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.48 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|