C29H28N2O2S — CID 135846710
(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-1-phenyl-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-5-one (PubChem CID 135846710) has the molecular formula C29H28N2O2S and a molecular weight of 468.62 g/mol. Its IUPAC name is (3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-1-phenyl-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-5-one.
| Compound Name | (3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-1-phenyl-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-5-one |
|---|---|
| PubChem CID | 135846710 |
| Molecular Formula | C29H28N2O2S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | (3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-imino-7,7-dimethyl-1-phenyl-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-5-one |
| SMILES | [H]/N=C1C(=C(/O)c2ccc(C)cc2)/C(c2cccs2)C2=C(CC(C)(C)CC2=O)N/1c1ccccc1 |
| InChI | InChI=1S/C29H28N2O2S/c1-18-11-13-19(14-12-18)27(33)26-25(23-10-7-15-34-23)24-21(16-29(2,3)17-22(24)32)31(28(26)30)20-8-5-4-6-9-20/h4-15,25,30,33H,16-17H2,1-3H3/b27-26+,30-28- |
| InChIKey | AXUXCLWACWWOBS-LXWBOPCWSA-N |
| XLogP | 7.25 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|